| 5,7-dihydroxy-3-(4-hydroxyphenyl)chromen-4-one; genistein; 4',5,7-trihydroxyisoflavone |
| Links: | 🌍 Wikipedia, 🕷 ChemSpider, 📖 PubMed |
| MeSH: | Anticarcinogenic Agents; Antineoplastic Agents; Enzyme Inhibitors; Estrogens; Hormones, Hormone Substitutes, and Hormone Antagonists; Protective Agents; Anticarcinogenic Agents; Antineoplastic Agents; Enzyme Inhibitors; Estrogens; Hormones, Hormone Substitutes, and Hormone Antagonists; Protective Agents |
| CAS RN: | [446-72-0] |
| Formula: | C15H10O5; 270.24 g/mol
|
| InChiKey: | TZBJGXHYKVUXJN-UHFFFAOYSA-N |
| SMILES: | Oc1ccc(cc1)C2=COc3cc(O)cc(O)c3C2=O |
 |
| Pharmaceutical use: | estrogenic |
| Melting point: | 300 °C |
